About ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate
ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate (PubChem CID 3242467) has the molecular formula C16H19N3O4S
and a molecular weight of 349.41 g/mol. Its IUPAC name is ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate |
| PubChem CID | 3242467 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)Cn2c(=O)sc3ccccc32)CC1 |
| InChI | InChI=1S/C16H19N3O4S/c1-2-23-15(21)18-9-7-17(8-10-18)14(20)11-19-12-5-3-4-6-13(12)24-16(19)22/h3-6H,2,7-11H2,1H3 |
| InChIKey | FSUBNPNHOSJHQD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate (CID 3242467) is ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(C(=O)Cn2c(=O)sc3ccccc32)CC1.
What is the InChIKey of ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate?
The InChIKey is FSUBNPNHOSJHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4S/c1-2-23-15(21)18-9-7-17(8-10-18)14(20)11-19-12-5-3-4-6-13(12)24-16(19)22/h3-6H,2,7-11H2,1H3.
What are the key properties of ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate?
ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate has a molecular weight of 349.41 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-(2-oxo-1,3-benzothiazol-3-yl)acetyl]piperazine-1-carboxylate is sourced from PubChem (CID 3242467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).