C23H28N4O6 — CID 3242511
6-O-cyclohexyl 2-O-methyl 7-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-2,6-dicarboxylate (PubChem CID 3242511) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is 6-O-cyclohexyl 2-O-methyl 7-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-2,6-dicarboxylate.
| Compound Name | 6-O-cyclohexyl 2-O-methyl 7-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 3242511 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 6-O-cyclohexyl 2-O-methyl 7-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-2,6-dicarboxylate |
| SMILES | COC(=O)c1nc2n(n1)C(c1cc(OC)ccc1OC)C(C(=O)OC1CCCCC1)=C(C)N2 |
| InChI | InChI=1S/C23H28N4O6/c1-13-18(21(28)33-14-8-6-5-7-9-14)19(16-12-15(30-2)10-11-17(16)31-3)27-23(24-13)25-20(26-27)22(29)32-4/h10-12,14,19H,5-9H2,1-4H3,(H,24,25,26) |
| InChIKey | XVWCXJSRFMACOL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |