C20H23NO5 — CID 3242555
4-(2-ethoxyphenyl)-5,6,7-trimethoxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 3242555) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)-5,6,7-trimethoxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 4-(2-ethoxyphenyl)-5,6,7-trimethoxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3242555 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-(2-ethoxyphenyl)-5,6,7-trimethoxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCOc1ccccc1C1CC(=O)Nc2cc(OC)c(OC)c(OC)c21 |
| InChI | InChI=1S/C20H23NO5/c1-5-26-15-9-7-6-8-12(15)13-10-17(22)21-14-11-16(23-2)19(24-3)20(25-4)18(13)14/h6-9,11,13H,5,10H2,1-4H3,(H,21,22) |
| InChIKey | YDHIVRPRJKHEDO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |