C20H20N2O4S — CID 3242582
5-[(4-methylphenyl)methylsulfonylmethyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide (PubChem CID 3242582) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 5-[(4-methylphenyl)methylsulfonylmethyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-methylphenyl)methylsulfonylmethyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3242582 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 5-[(4-methylphenyl)methylsulfonylmethyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide |
| SMILES | Cc1ccc(CS(=O)(=O)Cc2ccc(C(=O)NCc3cccnc3)o2)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-15-4-6-16(7-5-15)13-27(24,25)14-18-8-9-19(26-18)20(23)22-12-17-3-2-10-21-11-17/h2-11H,12-14H2,1H3,(H,22,23) |
| InChIKey | SAJMAYVMXOHUDU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |