About N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide
N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide (PubChem CID 3242609) has the molecular formula C15H19N3O4S
and a molecular weight of 337.40 g/mol. Its IUPAC name is N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide |
| PubChem CID | 3242609 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N(C)CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H19N3O4S/c1-11-15(12(2)22-17-11)23(20,21)18(3)10-14(19)16-9-13-7-5-4-6-8-13/h4-8H,9-10H2,1-3H3,(H,16,19) |
| InChIKey | CTTLCPDKTSILCW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide?
The IUPAC name of N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide (CID 3242609) is N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide.
What is the SMILES notation for N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide?
The canonical SMILES for N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide is Cc1noc(C)c1S(=O)(=O)N(C)CC(=O)NCc1ccccc1.
What is the InChIKey of N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide?
The InChIKey is CTTLCPDKTSILCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O4S/c1-11-15(12(2)22-17-11)23(20,21)18(3)10-14(19)16-9-13-7-5-4-6-8-13/h4-8H,9-10H2,1-3H3,(H,16,19).
What are the key properties of N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide?
N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide has a molecular weight of 337.40 g/mol, XLogP of 1.23, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl-methylamino]acetamide is sourced from PubChem (CID 3242609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).