About methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate
methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate (PubChem CID 3242646) has the molecular formula C18H25NO6S2
and a molecular weight of 415.53 g/mol. Its IUPAC name is methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate |
| PubChem CID | 3242646 |
| Molecular Formula | C18H25NO6S2 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate |
| SMILES | CCCS(=O)(=O)c1c(S(=O)(=O)CCC)c2cc(CC)ccn2c1C(=O)OC |
| InChI | InChI=1S/C18H25NO6S2/c1-5-10-26(21,22)16-14-12-13(7-3)8-9-19(14)15(18(20)25-4)17(16)27(23,24)11-6-2/h8-9,12H,5-7,10-11H2,1-4H3 |
| InChIKey | RPDSJPMMXLLMAO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 98.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
The IUPAC name of methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate (CID 3242646) is methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate.
What is the SMILES notation for methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
The canonical SMILES for methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate is CCCS(=O)(=O)c1c(S(=O)(=O)CCC)c2cc(CC)ccn2c1C(=O)OC.
What is the InChIKey of methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
The InChIKey is RPDSJPMMXLLMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO6S2/c1-5-10-26(21,22)16-14-12-13(7-3)8-9-19(14)15(18(20)25-4)17(16)27(23,24)11-6-2/h8-9,12H,5-7,10-11H2,1-4H3.
What are the key properties of methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate?
methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate has a molecular weight of 415.53 g/mol, XLogP of 2.66, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-ethyl-1,2-bis(propylsulfonyl)indolizine-3-carboxylate is sourced from PubChem (CID 3242646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).