About 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one
4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one (PubChem CID 3242706) has the molecular formula C20H22N4O3
and a molecular weight of 366.42 g/mol. Its IUPAC name is 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one |
| PubChem CID | 3242706 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one |
| SMILES | O=C(CCN1C(=O)COc2ccccc21)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H22N4O3/c25-19(23-13-11-22(12-14-23)18-7-3-4-9-21-18)8-10-24-16-5-1-2-6-17(16)27-15-20(24)26/h1-7,9H,8,10-15H2 |
| InChIKey | UOEOFHGLMAJDFM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one?
The IUPAC name of 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one (CID 3242706) is 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one?
The canonical SMILES for 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one is O=C(CCN1C(=O)COc2ccccc21)N1CCN(c2ccccn2)CC1.
What is the InChIKey of 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one?
The InChIKey is UOEOFHGLMAJDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O3/c25-19(23-13-11-22(12-14-23)18-7-3-4-9-21-18)8-10-24-16-5-1-2-6-17(16)27-15-20(24)26/h1-7,9H,8,10-15H2.
What are the key properties of 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one?
4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one has a molecular weight of 366.42 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1,4-benzoxazin-3-one is sourced from PubChem (CID 3242706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).