C16H16FN3O2S — CID 3242757
3-(2-fluorophenyl)-N-(2-methoxyethyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 3242757) has the molecular formula C16H16FN3O2S and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-(2-methoxyethyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-N-(2-methoxyethyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3242757 |
| Molecular Formula | C16H16FN3O2S |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-(2-fluorophenyl)-N-(2-methoxyethyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | COCCNC(=O)c1cc2c(-c3ccccc3F)nn(C)c2s1 |
| InChI | InChI=1S/C16H16FN3O2S/c1-20-16-11(9-13(23-16)15(21)18-7-8-22-2)14(19-20)10-5-3-4-6-12(10)17/h3-6,9H,7-8H2,1-2H3,(H,18,21) |
| InChIKey | ZOJPIICMQQPHGR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|