About 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide
1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide (PubChem CID 3242798) has the molecular formula C21H27N3O2
and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide |
| PubChem CID | 3242798 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CCCN(c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C21H27N3O2/c25-20(22-13-12-16-7-2-1-3-8-16)17-9-6-14-24(15-17)21-23-18-10-4-5-11-19(18)26-21/h4-5,7,10-11,17H,1-3,6,8-9,12-15H2,(H,22,25) |
| InChIKey | OCCIFDIVOTVYEU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide?
The IUPAC name of 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide (CID 3242798) is 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide.
What is the SMILES notation for 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide?
The canonical SMILES for 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide is O=C(NCCC1=CCCCC1)C1CCCN(c2nc3ccccc3o2)C1.
What is the InChIKey of 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide?
The InChIKey is OCCIFDIVOTVYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O2/c25-20(22-13-12-16-7-2-1-3-8-16)17-9-6-14-24(15-17)21-23-18-10-4-5-11-19(18)26-21/h4-5,7,10-11,17H,1-3,6,8-9,12-15H2,(H,22,25).
What are the key properties of 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide?
1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide has a molecular weight of 353.47 g/mol, XLogP of 4.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzoxazol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide is sourced from PubChem (CID 3242798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).