About 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one
3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one (PubChem CID 3242879) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one.
Molecular Properties
| Compound Name | 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one |
| PubChem CID | 3242879 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one |
| SMILES | Cc1cc(C)c(C(=O)CC2(O)C(=O)Nc3ccccc32)cc1C |
| InChI | InChI=1S/C19H19NO3/c1-11-8-13(3)14(9-12(11)2)17(21)10-19(23)15-6-4-5-7-16(15)20-18(19)22/h4-9,23H,10H2,1-3H3,(H,20,22) |
| InChIKey | USRORBOLLJWNMP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one?
The IUPAC name of 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one (CID 3242879) is 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one.
What is the SMILES notation for 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one?
The canonical SMILES for 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one is Cc1cc(C)c(C(=O)CC2(O)C(=O)Nc3ccccc32)cc1C.
What is the InChIKey of 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one?
The InChIKey is USRORBOLLJWNMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO3/c1-11-8-13(3)14(9-12(11)2)17(21)10-19(23)15-6-4-5-7-16(15)20-18(19)22/h4-9,23H,10H2,1-3H3,(H,20,22).
What are the key properties of 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one?
3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one has a molecular weight of 309.37 g/mol, XLogP of 3.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1H-indol-2-one is sourced from PubChem (CID 3242879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).