C19H26BrN3O2S2 — CID 3242881
4-bromo-N-[1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide (PubChem CID 3242881) has the molecular formula C19H26BrN3O2S2 and a molecular weight of 472.47 g/mol. Its IUPAC name is 4-bromo-N-[1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3242881 |
| Molecular Formula | C19H26BrN3O2S2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 4-bromo-N-[1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]benzenesulfonamide |
| SMILES | CCN1CCN(C(c2cccs2)C(C)NS(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H26BrN3O2S2/c1-3-22-10-12-23(13-11-22)19(18-5-4-14-26-18)15(2)21-27(24,25)17-8-6-16(20)7-9-17/h4-9,14-15,19,21H,3,10-13H2,1-2H3 |
| InChIKey | NTRYPVBJLOOOHU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |