C16H17N3O4S — CID 3242965
N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3,4,5-trimethoxybenzamide (PubChem CID 3242965) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3242965 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2cn3ccsc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C16H17N3O4S/c1-21-12-6-10(7-13(22-2)14(12)23-3)15(20)17-8-11-9-19-4-5-24-16(19)18-11/h4-7,9H,8H2,1-3H3,(H,17,20) |
| InChIKey | PRRRXPOHSJADPQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |