About N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide
N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide (PubChem CID 3243110) has the molecular formula C9H13N3O2S2
and a molecular weight of 259.36 g/mol. Its IUPAC name is N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide |
| PubChem CID | 3243110 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCc1cn2c(C)csc2n1 |
| InChI | InChI=1S/C9H13N3O2S2/c1-3-16(13,14)10-4-8-5-12-7(2)6-15-9(12)11-8/h5-6,10H,3-4H2,1-2H3 |
| InChIKey | LLPDYPIAJRAGKH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide?
The IUPAC name of N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide (CID 3243110) is N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide.
What is the SMILES notation for N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide?
The canonical SMILES for N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide is CCS(=O)(=O)NCc1cn2c(C)csc2n1.
What is the InChIKey of N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide?
The InChIKey is LLPDYPIAJRAGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2S2/c1-3-16(13,14)10-4-8-5-12-7(2)6-15-9(12)11-8/h5-6,10H,3-4H2,1-2H3.
What are the key properties of N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide?
N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide has a molecular weight of 259.36 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]ethanesulfonamide is sourced from PubChem (CID 3243110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).