About 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide
2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide (PubChem CID 3243187) has the molecular formula C22H20N4O4S
and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide |
| PubChem CID | 3243187 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1ccc(N(CC(=O)Nc2cccc(C)c2)S(=O)(=O)c2cccc3nonc23)cc1 |
| InChI | InChI=1S/C22H20N4O4S/c1-15-9-11-18(12-10-15)26(14-21(27)23-17-6-3-5-16(2)13-17)31(28,29)20-8-4-7-19-22(20)25-30-24-19/h3-13H,14H2,1-2H3,(H,23,27) |
| InChIKey | YEFBNFHEMZJOFU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|
Analyze 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide?
The IUPAC name of 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide (CID 3243187) is 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide.
What is the SMILES notation for 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide?
The canonical SMILES for 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide is Cc1ccc(N(CC(=O)Nc2cccc(C)c2)S(=O)(=O)c2cccc3nonc23)cc1.
What is the InChIKey of 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide?
The InChIKey is YEFBNFHEMZJOFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O4S/c1-15-9-11-18(12-10-15)26(14-21(27)23-17-6-3-5-16(2)13-17)31(28,29)20-8-4-7-19-22(20)25-30-24-19/h3-13H,14H2,1-2H3,(H,23,27).
What are the key properties of 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide?
2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide has a molecular weight of 436.49 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-(2,1,3-benzoxadiazol-4-ylsulfonyl)-4-methylanilino]-N-(3-methylphenyl)acetamide is sourced from PubChem (CID 3243187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).