About 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide
5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide (PubChem CID 3243233) has the molecular formula C17H20FN3O3
and a molecular weight of 333.36 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 3243233 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cc(-c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C17H20FN3O3/c18-14-4-2-13(3-5-14)16-12-15(20-24-16)17(22)19-6-1-7-21-8-10-23-11-9-21/h2-5,12H,1,6-11H2,(H,19,22) |
| InChIKey | RSNFDGVUQFYATD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide (CID 3243233) is 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide is O=C(NCCCN1CCOCC1)c1cc(-c2ccc(F)cc2)on1.
What is the InChIKey of 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide?
The InChIKey is RSNFDGVUQFYATD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN3O3/c18-14-4-2-13(3-5-14)16-12-15(20-24-16)17(22)19-6-1-7-21-8-10-23-11-9-21/h2-5,12H,1,6-11H2,(H,19,22).
What are the key properties of 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide?
5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide has a molecular weight of 333.36 g/mol, XLogP of 1.93, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 3243233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).