About 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol
4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol (PubChem CID 3243408) has the molecular formula C18H19N3OS
and a molecular weight of 325.44 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol |
| PubChem CID | 3243408 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol |
| SMILES | C=CCN1/C(=N/c2cccnc2)SCC1(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19N3OS/c1-3-11-21-17(20-16-5-4-10-19-12-16)23-13-18(21,22)15-8-6-14(2)7-9-15/h3-10,12,22H,1,11,13H2,2H3/b20-17- |
| InChIKey | WZTRFZMCHBAZNP-JZJYNLBNSA-N |
| XLogP | 3.46 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
The IUPAC name of 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol (CID 3243408) is 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol.
What is the SMILES notation for 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
The canonical SMILES for 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol is C=CCN1/C(=N/c2cccnc2)SCC1(O)c1ccc(C)cc1.
What is the InChIKey of 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
The InChIKey is WZTRFZMCHBAZNP-JZJYNLBNSA-N. The full InChI is InChI=1S/C18H19N3OS/c1-3-11-21-17(20-16-5-4-10-19-12-16)23-13-18(21,22)15-8-6-14(2)7-9-15/h3-10,12,22H,1,11,13H2,2H3/b20-17-.
What are the key properties of 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol has a molecular weight of 325.44 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol is sourced from PubChem (CID 3243408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).