C18H26INO4 — CID 3243438
2-(diethylamino)ethyl 5-(methoxymethyl)-1-benzofuran-2-carboxylate;iodomethane (PubChem CID 3243438) has the molecular formula C18H26INO4 and a molecular weight of 447.31 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 5-(methoxymethyl)-1-benzofuran-2-carboxylate;iodomethane.
| Compound Name | 2-(diethylamino)ethyl 5-(methoxymethyl)-1-benzofuran-2-carboxylate;iodomethane |
|---|---|
| PubChem CID | 3243438 |
| Molecular Formula | C18H26INO4 |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-(diethylamino)ethyl 5-(methoxymethyl)-1-benzofuran-2-carboxylate;iodomethane |
| SMILES | CCN(CC)CCOC(=O)c1cc2cc(COC)ccc2o1.CI |
| InChI | InChI=1S/C17H23NO4.CH3I/c1-4-18(5-2)8-9-21-17(19)16-11-14-10-13(12-20-3)6-7-15(14)22-16;1-2/h6-7,10-11H,4-5,8-9,12H2,1-3H3;1H3 |
| InChIKey | LKWCNZWKYASIAJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|