About 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one
3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one (PubChem CID 3243478) has the molecular formula C22H23N3O2S
and a molecular weight of 393.51 g/mol. Its IUPAC name is 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one.
Molecular Properties
| Compound Name | 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one |
| PubChem CID | 3243478 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one |
| SMILES | C=CCN1C(=O)c2ccccc2Sc2ccc(C(=O)N3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C22H23N3O2S/c1-3-10-25-18-15-16(21(26)24-13-11-23(2)12-14-24)8-9-20(18)28-19-7-5-4-6-17(19)22(25)27/h3-9,15H,1,10-14H2,2H3 |
| InChIKey | WWDATGFAYIDQCQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one?
The IUPAC name of 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one (CID 3243478) is 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one.
What is the SMILES notation for 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one?
The canonical SMILES for 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one is C=CCN1C(=O)c2ccccc2Sc2ccc(C(=O)N3CCN(C)CC3)cc21.
What is the InChIKey of 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one?
The InChIKey is WWDATGFAYIDQCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O2S/c1-3-10-25-18-15-16(21(26)24-13-11-23(2)12-14-24)8-9-20(18)28-19-7-5-4-6-17(19)22(25)27/h3-9,15H,1,10-14H2,2H3.
What are the key properties of 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one?
3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one has a molecular weight of 393.51 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylpiperazine-1-carbonyl)-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one is sourced from PubChem (CID 3243478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).