About N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide
N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide (PubChem CID 3243514) has the molecular formula C23H26N2O5
and a molecular weight of 410.47 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide.
Molecular Properties
| Compound Name | N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide |
| PubChem CID | 3243514 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide |
| SMILES | CCOc1ccc(-c2cc(CCCC(=O)Nc3cc(OC)ccc3OC)no2)cc1 |
| InChI | InChI=1S/C23H26N2O5/c1-4-29-18-10-8-16(9-11-18)22-14-17(25-30-22)6-5-7-23(26)24-20-15-19(27-2)12-13-21(20)28-3/h8-15H,4-7H2,1-3H3,(H,24,26) |
| InChIKey | QKBMJXWTFKVSCO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide?
The IUPAC name of N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide (CID 3243514) is N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide.
What is the SMILES notation for N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide?
The canonical SMILES for N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide is CCOc1ccc(-c2cc(CCCC(=O)Nc3cc(OC)ccc3OC)no2)cc1.
What is the InChIKey of N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide?
The InChIKey is QKBMJXWTFKVSCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O5/c1-4-29-18-10-8-16(9-11-18)22-14-17(25-30-22)6-5-7-23(26)24-20-15-19(27-2)12-13-21(20)28-3/h8-15H,4-7H2,1-3H3,(H,24,26).
What are the key properties of N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide?
N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide has a molecular weight of 410.47 g/mol, XLogP of 4.72, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethoxyphenyl)-4-[5-(4-ethoxyphenyl)-1,2-oxazol-3-yl]butanamide is sourced from PubChem (CID 3243514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).