About ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate
ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate (PubChem CID 3243733) has the molecular formula C18H22N4O5
and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate |
| PubChem CID | 3243733 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(=O)n(-c3ccc(OC)cc3)c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C18H22N4O5/c1-3-27-18(25)21-10-8-20(9-11-21)15-12-16(23)22(17(24)19-15)13-4-6-14(26-2)7-5-13/h4-7,12H,3,8-11H2,1-2H3,(H,19,24) |
| InChIKey | OFUKJESAMWCDRV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate (CID 3243733) is ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate is CCOC(=O)N1CCN(c2cc(=O)n(-c3ccc(OC)cc3)c(=O)[nH]2)CC1.
What is the InChIKey of ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate?
The InChIKey is OFUKJESAMWCDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O5/c1-3-27-18(25)21-10-8-20(9-11-21)15-12-16(23)22(17(24)19-15)13-4-6-14(26-2)7-5-13/h4-7,12H,3,8-11H2,1-2H3,(H,19,24).
What are the key properties of ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate?
ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate has a molecular weight of 374.40 g/mol, XLogP of 0.81, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-(4-methoxyphenyl)-2,4-dioxo-1H-pyrimidin-6-yl]piperazine-1-carboxylate is sourced from PubChem (CID 3243733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).