About 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole
6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole (PubChem CID 3243735) has the molecular formula C13H14N2O2S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole.
Molecular Properties
| Compound Name | 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
| PubChem CID | 3243735 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
| SMILES | c1c2c(cc3sc(N4CCCCC4)nc13)OCO2 |
| InChI | InChI=1S/C13H14N2O2S/c1-2-4-15(5-3-1)13-14-9-6-10-11(17-8-16-10)7-12(9)18-13/h6-7H,1-5,8H2 |
| InChIKey | ONDYVKVDWDODQE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole?
The IUPAC name of 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole (CID 3243735) is 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole.
What is the SMILES notation for 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole?
The canonical SMILES for 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole is c1c2c(cc3sc(N4CCCCC4)nc13)OCO2.
What is the InChIKey of 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole?
The InChIKey is ONDYVKVDWDODQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2S/c1-2-4-15(5-3-1)13-14-9-6-10-11(17-8-16-10)7-12(9)18-13/h6-7H,1-5,8H2.
What are the key properties of 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole?
6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole has a molecular weight of 262.33 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperidin-1-yl-[1,3]dioxolo[4,5-f][1,3]benzothiazole is sourced from PubChem (CID 3243735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).