About 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide
4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide (PubChem CID 3243740) has the molecular formula C8H13N3OS2
and a molecular weight of 231.35 g/mol. Its IUPAC name is 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| PubChem CID | 3243740 |
| Molecular Formula | C8H13N3OS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| SMILES | CCNC(=O)c1sc(=S)n(CC)c1N |
| InChI | InChI=1S/C8H13N3OS2/c1-3-10-7(12)5-6(9)11(4-2)8(13)14-5/h3-4,9H2,1-2H3,(H,10,12) |
| InChIKey | JLQFLBFJAQCRIZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide (CID 3243740) is 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide is CCNC(=O)c1sc(=S)n(CC)c1N.
What is the InChIKey of 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide?
The InChIKey is JLQFLBFJAQCRIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS2/c1-3-10-7(12)5-6(9)11(4-2)8(13)14-5/h3-4,9H2,1-2H3,(H,10,12).
What are the key properties of 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide?
4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide has a molecular weight of 231.35 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,3-diethyl-2-sulfanylidene-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 3243740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).