About (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate
(2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate (PubChem CID 3243755) has the molecular formula C15H17N5O5
and a molecular weight of 347.33 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate |
| PubChem CID | 3243755 |
| Molecular Formula | C15H17N5O5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate |
| SMILES | COc1nc(Oc2ccc(C(=O)OCC(N)=O)cc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C15H17N5O5/c1-20(2)13-17-14(23-3)19-15(18-13)25-10-6-4-9(5-7-10)12(22)24-8-11(16)21/h4-7H,8H2,1-3H3,(H2,16,21) |
| InChIKey | NGWFCPFXPSNWLL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 129.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate?
The IUPAC name of (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate (CID 3243755) is (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate.
What is the SMILES notation for (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate?
The canonical SMILES for (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate is COc1nc(Oc2ccc(C(=O)OCC(N)=O)cc2)nc(N(C)C)n1.
What is the InChIKey of (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate?
The InChIKey is NGWFCPFXPSNWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O5/c1-20(2)13-17-14(23-3)19-15(18-13)25-10-6-4-9(5-7-10)12(22)24-8-11(16)21/h4-7H,8H2,1-3H3,(H2,16,21).
What are the key properties of (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate?
(2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate has a molecular weight of 347.33 g/mol, XLogP of 0.38, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) 4-[[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]oxy]benzoate is sourced from PubChem (CID 3243755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).