About N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide
N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide (PubChem CID 3243842) has the molecular formula C21H18N4O4
and a molecular weight of 390.40 g/mol. Its IUPAC name is N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide.
Molecular Properties
| Compound Name | N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide |
| PubChem CID | 3243842 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(-c2cnnn2-c2ccc(NC(=O)c3ccco3)cc2)cc1OC |
| InChI | InChI=1S/C21H18N4O4/c1-27-18-10-5-14(12-20(18)28-2)17-13-22-24-25(17)16-8-6-15(7-9-16)23-21(26)19-4-3-11-29-19/h3-13H,1-2H3,(H,23,26) |
| InChIKey | KOCIDWRLBKEZHJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide?
The IUPAC name of N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide (CID 3243842) is N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide.
What is the SMILES notation for N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide?
The canonical SMILES for N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide is COc1ccc(-c2cnnn2-c2ccc(NC(=O)c3ccco3)cc2)cc1OC.
What is the InChIKey of N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide?
The InChIKey is KOCIDWRLBKEZHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O4/c1-27-18-10-5-14(12-20(18)28-2)17-13-22-24-25(17)16-8-6-15(7-9-16)23-21(26)19-4-3-11-29-19/h3-13H,1-2H3,(H,23,26).
What are the key properties of N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide?
N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide has a molecular weight of 390.40 g/mol, XLogP of 3.80, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[5-(3,4-dimethoxyphenyl)triazol-1-yl]phenyl]furan-2-carboxamide is sourced from PubChem (CID 3243842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).