About 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one
2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one (PubChem CID 3243853) has the molecular formula C16H12N4O2
and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one.
Molecular Properties
| Compound Name | 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one |
| PubChem CID | 3243853 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one |
| SMILES | O=c1c2ccccc2nc2ccc(NCc3ccco3)nn12 |
| InChI | InChI=1S/C16H12N4O2/c21-16-12-5-1-2-6-13(12)18-15-8-7-14(19-20(15)16)17-10-11-4-3-9-22-11/h1-9H,10H2,(H,17,19) |
| InChIKey | AFLJNINVGDQBOC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one?
The IUPAC name of 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one (CID 3243853) is 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one.
What is the SMILES notation for 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one?
The canonical SMILES for 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one is O=c1c2ccccc2nc2ccc(NCc3ccco3)nn12.
What is the InChIKey of 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one?
The InChIKey is AFLJNINVGDQBOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O2/c21-16-12-5-1-2-6-13(12)18-15-8-7-14(19-20(15)16)17-10-11-4-3-9-22-11/h1-9H,10H2,(H,17,19).
What are the key properties of 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one?
2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one has a molecular weight of 292.30 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-ylmethylamino)pyridazino[6,1-b]quinazolin-10-one is sourced from PubChem (CID 3243853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).