C14H15F6N3O4 — CID 3243864
ethyl 3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)carbamoylamino]-2-(2,2,2-trifluoroethoxy)propanoate (PubChem CID 3243864) has the molecular formula C14H15F6N3O4 and a molecular weight of 403.28 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)carbamoylamino]-2-(2,2,2-trifluoroethoxy)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)carbamoylamino]-2-(2,2,2-trifluoroethoxy)propanoate |
|---|---|
| PubChem CID | 3243864 |
| Molecular Formula | C14H15F6N3O4 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)carbamoylamino]-2-(2,2,2-trifluoroethoxy)propanoate |
| SMILES | CCOC(=O)C(NC(=O)Nc1cccc(C)n1)(OCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H15F6N3O4/c1-3-26-10(24)13(14(18,19)20,27-7-12(15,16)17)23-11(25)22-9-6-4-5-8(2)21-9/h4-6H,3,7H2,1-2H3,(H2,21,22,23,25) |
| InChIKey | KBWLBUHVNPFZOP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|