About 2-isoquinolin-1-ylindene-1,3-dione
2-isoquinolin-1-ylindene-1,3-dione (PubChem CID 3243985) has the molecular formula C18H11NO2
and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-isoquinolin-1-ylindene-1,3-dione.
Molecular Properties
| Compound Name | 2-isoquinolin-1-ylindene-1,3-dione |
| PubChem CID | 3243985 |
| Molecular Formula | C18H11NO2 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-isoquinolin-1-ylindene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1c1nccc2ccccc12 |
| InChI | InChI=1S/C18H11NO2/c20-17-13-7-3-4-8-14(13)18(21)15(17)16-12-6-2-1-5-11(12)9-10-19-16/h1-10,15H |
| InChIKey | KXIAYOHGMQBMRT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-isoquinolin-1-ylindene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isoquinolin-1-ylindene-1,3-dione?
The IUPAC name of 2-isoquinolin-1-ylindene-1,3-dione (CID 3243985) is 2-isoquinolin-1-ylindene-1,3-dione.
What is the SMILES notation for 2-isoquinolin-1-ylindene-1,3-dione?
The canonical SMILES for 2-isoquinolin-1-ylindene-1,3-dione is O=C1c2ccccc2C(=O)C1c1nccc2ccccc12.
What is the InChIKey of 2-isoquinolin-1-ylindene-1,3-dione?
The InChIKey is KXIAYOHGMQBMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NO2/c20-17-13-7-3-4-8-14(13)18(21)15(17)16-12-6-2-1-5-11(12)9-10-19-16/h1-10,15H.
What are the key properties of 2-isoquinolin-1-ylindene-1,3-dione?
2-isoquinolin-1-ylindene-1,3-dione has a molecular weight of 273.29 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isoquinolin-1-ylindene-1,3-dione is sourced from PubChem (CID 3243985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).