C18H18N2O4S2 — CID 3244156
2,5-dimethoxy-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]benzenesulfonamide (PubChem CID 3244156) has the molecular formula C18H18N2O4S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3244156 |
| Molecular Formula | C18H18N2O4S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2,5-dimethoxy-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCc2csc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C18H18N2O4S2/c1-23-15-8-9-16(24-2)17(10-15)26(21,22)19-11-14-12-25-18(20-14)13-6-4-3-5-7-13/h3-10,12,19H,11H2,1-2H3 |
| InChIKey | OSZSWXGXJGRLQV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |