C20H27N3O5 — CID 3244264
ethyl 4-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanoylamino]piperidine-1-carboxylate (PubChem CID 3244264) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is ethyl 4-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3244264 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | ethyl 4-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCN2C(=O)C3C4C=CC(C4)C3C2=O)CC1 |
| InChI | InChI=1S/C20H27N3O5/c1-2-28-20(27)22-8-5-14(6-9-22)21-15(24)7-10-23-18(25)16-12-3-4-13(11-12)17(16)19(23)26/h3-4,12-14,16-17H,2,5-11H2,1H3,(H,21,24) |
| InChIKey | JRKZFRRAYVKIKE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|