C17H21F3N2O3 — CID 3244284
ethyl 3,3,3-trifluoro-2-phenyl-2-(piperidine-1-carbonylamino)propanoate (PubChem CID 3244284) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-phenyl-2-(piperidine-1-carbonylamino)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-phenyl-2-(piperidine-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 3244284 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-phenyl-2-(piperidine-1-carbonylamino)propanoate |
| SMILES | CCOC(=O)C(NC(=O)N1CCCCC1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N2O3/c1-2-25-14(23)16(17(18,19)20,13-9-5-3-6-10-13)21-15(24)22-11-7-4-8-12-22/h3,5-6,9-10H,2,4,7-8,11-12H2,1H3,(H,21,24) |
| InChIKey | JILBSTNZAQRNJB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |