C11H13ClN2O2 — CID 3244484
N-[2-(4-chlorophenyl)ethyl]-2-formamidoacetamide (PubChem CID 3244484) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-formamidoacetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-formamidoacetamide |
|---|---|
| PubChem CID | 3244484 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-formamidoacetamide |
| SMILES | O=CNCC(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClN2O2/c12-10-3-1-9(2-4-10)5-6-14-11(16)7-13-8-15/h1-4,8H,5-7H2,(H,13,15)(H,14,16) |
| InChIKey | UXRIDYJLBJVJSG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|