About N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide
N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide (PubChem CID 3244494) has the molecular formula C24H27FN2O3S
and a molecular weight of 442.56 g/mol. Its IUPAC name is N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide.
Molecular Properties
| Compound Name | N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide |
| PubChem CID | 3244494 |
| Molecular Formula | C24H27FN2O3S |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)c1ccc2c(c1)N(Cc1ccc(F)cc1)C(=O)CS2=O |
| InChI | InChI=1S/C24H27FN2O3S/c25-19-11-8-17(9-12-19)15-27-21-14-18(10-13-22(21)31(30)16-23(27)28)24(29)26-20-6-4-2-1-3-5-7-20/h8-14,20H,1-7,15-16H2,(H,26,29) |
| InChIKey | LOWYQMZZIDFCFD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide?
The IUPAC name of N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide (CID 3244494) is N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide.
What is the SMILES notation for N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide?
The canonical SMILES for N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide is O=C(NC1CCCCCCC1)c1ccc2c(c1)N(Cc1ccc(F)cc1)C(=O)CS2=O.
What is the InChIKey of N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide?
The InChIKey is LOWYQMZZIDFCFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27FN2O3S/c25-19-11-8-17(9-12-19)15-27-21-14-18(10-13-22(21)31(30)16-23(27)28)24(29)26-20-6-4-2-1-3-5-7-20/h8-14,20H,1-7,15-16H2,(H,26,29).
What are the key properties of N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide?
N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide has a molecular weight of 442.56 g/mol, XLogP of 4.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclooctyl-4-[(4-fluorophenyl)methyl]-1,3-dioxo-1lambda4,4-benzothiazine-6-carboxamide is sourced from PubChem (CID 3244494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).