C21H24N4O4 — CID 3244526
2-(12-ethyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[4-(furan-2-yl)butan-2-yl]propanamide (PubChem CID 3244526) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-(12-ethyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[4-(furan-2-yl)butan-2-yl]propanamide.
| Compound Name | 2-(12-ethyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[4-(furan-2-yl)butan-2-yl]propanamide |
|---|---|
| PubChem CID | 3244526 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-(12-ethyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[4-(furan-2-yl)butan-2-yl]propanamide |
| SMILES | CCc1nn(C(C)C(=O)NC(C)CCc2ccco2)c(=O)c2cc3occc3n12 |
| InChI | InChI=1S/C21H24N4O4/c1-4-19-23-25(21(27)17-12-18-16(24(17)19)9-11-29-18)14(3)20(26)22-13(2)7-8-15-6-5-10-28-15/h5-6,9-14H,4,7-8H2,1-3H3,(H,22,26) |
| InChIKey | QBDMSRDFZMFARG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |