About 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole
6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole (PubChem CID 3244537) has the molecular formula C12H8N2O2S
and a molecular weight of 244.28 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole |
| PubChem CID | 3244537 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole |
| SMILES | c1cn2cc(-c3ccc4c(c3)OCO4)nc2s1 |
| InChI | InChI=1S/C12H8N2O2S/c1-2-10-11(16-7-15-10)5-8(1)9-6-14-3-4-17-12(14)13-9/h1-6H,7H2 |
| InChIKey | HYXXORLKYUZUGN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole?
The IUPAC name of 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole (CID 3244537) is 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole is c1cn2cc(-c3ccc4c(c3)OCO4)nc2s1.
What is the InChIKey of 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole?
The InChIKey is HYXXORLKYUZUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2S/c1-2-10-11(16-7-15-10)5-8(1)9-6-14-3-4-17-12(14)13-9/h1-6H,7H2.
What are the key properties of 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole?
6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole has a molecular weight of 244.28 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzodioxol-5-yl)imidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 3244537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).