About 2-amino-5,7-dimethylquinolin-8-ol
2-amino-5,7-dimethylquinolin-8-ol (PubChem CID 3244543) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-amino-5,7-dimethylquinolin-8-ol.
Molecular Properties
| Compound Name | 2-amino-5,7-dimethylquinolin-8-ol |
| PubChem CID | 3244543 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-amino-5,7-dimethylquinolin-8-ol |
| SMILES | Cc1cc(C)c2ccc(N)nc2c1O |
| InChI | InChI=1S/C11H12N2O/c1-6-5-7(2)11(14)10-8(6)3-4-9(12)13-10/h3-5,14H,1-2H3,(H2,12,13) |
| InChIKey | YWPKMBRQRWADNC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-5,7-dimethylquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5,7-dimethylquinolin-8-ol?
The IUPAC name of 2-amino-5,7-dimethylquinolin-8-ol (CID 3244543) is 2-amino-5,7-dimethylquinolin-8-ol.
What is the SMILES notation for 2-amino-5,7-dimethylquinolin-8-ol?
The canonical SMILES for 2-amino-5,7-dimethylquinolin-8-ol is Cc1cc(C)c2ccc(N)nc2c1O.
What is the InChIKey of 2-amino-5,7-dimethylquinolin-8-ol?
The InChIKey is YWPKMBRQRWADNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-6-5-7(2)11(14)10-8(6)3-4-9(12)13-10/h3-5,14H,1-2H3,(H2,12,13).
What are the key properties of 2-amino-5,7-dimethylquinolin-8-ol?
2-amino-5,7-dimethylquinolin-8-ol has a molecular weight of 188.23 g/mol, XLogP of 2.14, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,7-dimethylquinolin-8-ol is sourced from PubChem (CID 3244543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).