About 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide
1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide (PubChem CID 3244635) has the molecular formula C19H26N4O3
and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide |
| PubChem CID | 3244635 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C19H26N4O3/c24-18(20-7-10-22-11-13-25-14-12-22)15-5-8-23(9-6-15)19-21-16-3-1-2-4-17(16)26-19/h1-4,15H,5-14H2,(H,20,24) |
| InChIKey | BBDPKDCDSQRFRW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide?
The IUPAC name of 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide (CID 3244635) is 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide.
What is the SMILES notation for 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide?
The canonical SMILES for 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide is O=C(NCCN1CCOCC1)C1CCN(c2nc3ccccc3o2)CC1.
What is the InChIKey of 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide?
The InChIKey is BBDPKDCDSQRFRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O3/c24-18(20-7-10-22-11-13-25-14-12-22)15-5-8-23(9-6-15)19-21-16-3-1-2-4-17(16)26-19/h1-4,15H,5-14H2,(H,20,24).
What are the key properties of 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide?
1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide has a molecular weight of 358.44 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzoxazol-2-yl)-N-(2-morpholin-4-ylethyl)piperidine-4-carboxamide is sourced from PubChem (CID 3244635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).