C24H32ClN7O — CID 3244686
N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide (PubChem CID 3244686) has the molecular formula C24H32ClN7O and a molecular weight of 470.02 g/mol. Its IUPAC name is N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide.
| Compound Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide |
|---|---|
| PubChem CID | 3244686 |
| Molecular Formula | C24H32ClN7O |
| Molecular Weight | 470.02 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide |
| SMILES | Cc1nc2nc(C)c(CCC(=O)NCCCN3CCN(c4cccc(Cl)c4)CC3)c(C)n2n1 |
| InChI | InChI=1S/C24H32ClN7O/c1-17-22(18(2)32-24(27-17)28-19(3)29-32)8-9-23(33)26-10-5-11-30-12-14-31(15-13-30)21-7-4-6-20(25)16-21/h4,6-7,16H,5,8-15H2,1-3H3,(H,26,33) |
| InChIKey | GXWZOOGNJIZESN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.02 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|