C25H29N3O2 — CID 3244689
11-[4-(dimethylamino)phenyl]-10-isobutyryl-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one (PubChem CID 3244689) has the molecular formula C25H29N3O2 and a molecular weight of 403.50 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-5-(2-methylpropanoyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 11-[4-(dimethylamino)phenyl]-10-isobutyryl-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one |
|---|---|
| PubChem CID | 3244689 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-5-(2-methylpropanoyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC(C)C(=O)N1C(C2=C(CCCC2=O)NC3=CC=CC=C31)C4=CC=C(C=C4)N(C)C |
| InChI | InChI=1S/C25H29N3O2/c1-16(2)25(30)28-21-10-6-5-8-19(21)26-20-9-7-11-22(29)23(20)24(28)17-12-14-18(15-13-17)27(3)4/h5-6,8,10,12-16,24,26H,7,9,11H2,1-4H3 |
| InChIKey | WRQISNPIEJMADD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | 691 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |