2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid

C19H17NO3 — CID 3244695

IUPAC2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid
SMILESO=C(O)c1ccccc1C(=O)N1CC=C(c2ccccc2)CC1
InChIInChI=1S/C19H17NO3/c21-18(16-8-4-5-9-17(16)19(22)23)20-12-10-15(11-13-20)14-6-2-1-3-7-14/h1-10H,11-13H2,(H,22,23)
InChIKeyOGRFDILVSOTYEZ-UHFFFAOYSA-N
MW307.35 g/mol
LogP3.31
Rot. Bonds3

About 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid

2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid (PubChem CID 3244695) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid.

Molecular Properties

Compound Name2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid
PubChem CID3244695
Molecular FormulaC19H17NO3
Molecular Weight307.35 g/mol
Exact Mass307.12
IUPAC Name2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid
SMILESO=C(O)c1ccccc1C(=O)N1CC=C(c2ccccc2)CC1
InChIInChI=1S/C19H17NO3/c21-18(16-8-4-5-9-17(16)19(22)23)20-12-10-15(11-13-20)14-6-2-1-3-7-14/h1-10H,11-13H2,(H,22,23)
InChIKeyOGRFDILVSOTYEZ-UHFFFAOYSA-N
XLogP3.31
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.35
LogP ≤ 53.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid?
The IUPAC name of 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid (CID 3244695) is 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid.
What is the SMILES notation for 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid?
The canonical SMILES for 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid is O=C(O)c1ccccc1C(=O)N1CC=C(c2ccccc2)CC1.
What is the InChIKey of 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid?
The InChIKey is OGRFDILVSOTYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO3/c21-18(16-8-4-5-9-17(16)19(22)23)20-12-10-15(11-13-20)14-6-2-1-3-7-14/h1-10H,11-13H2,(H,22,23).
What are the key properties of 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid?
2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid has a molecular weight of 307.35 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzoic acid is sourced from PubChem (CID 3244695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).