About 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea
1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea (PubChem CID 3244803) has the molecular formula C16H16N4O2S
and a molecular weight of 328.40 g/mol. Its IUPAC name is 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea.
Molecular Properties
| Compound Name | 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea |
| PubChem CID | 3244803 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea |
| SMILES | Cc1ccnc(NC(=O)Nc2ccc3c(c2)N(C)C(=O)CS3)c1 |
| InChI | InChI=1S/C16H16N4O2S/c1-10-5-6-17-14(7-10)19-16(22)18-11-3-4-13-12(8-11)20(2)15(21)9-23-13/h3-8H,9H2,1-2H3,(H2,17,18,19,22) |
| InChIKey | LMOXFKDLNQLUFA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea?
The IUPAC name of 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea (CID 3244803) is 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea.
What is the SMILES notation for 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea?
The canonical SMILES for 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea is Cc1ccnc(NC(=O)Nc2ccc3c(c2)N(C)C(=O)CS3)c1.
What is the InChIKey of 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea?
The InChIKey is LMOXFKDLNQLUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2S/c1-10-5-6-17-14(7-10)19-16(22)18-11-3-4-13-12(8-11)20(2)15(21)9-23-13/h3-8H,9H2,1-2H3,(H2,17,18,19,22).
What are the key properties of 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea?
1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea has a molecular weight of 328.40 g/mol, XLogP of 3.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-3-oxo-1,4-benzothiazin-6-yl)-3-(4-methyl-2-pyridinyl)urea is sourced from PubChem (CID 3244803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).