C20H27FN2O2 — CID 3244804
1-cycloheptyl-3-(2-fluorophenyl)-4-propan-2-ylpiperazine-2,5-dione (PubChem CID 3244804) has the molecular formula C20H27FN2O2 and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-cycloheptyl-3-(2-fluorophenyl)-4-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 1-cycloheptyl-3-(2-fluorophenyl)-4-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 3244804 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-cycloheptyl-3-(2-fluorophenyl)-4-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)N1C(=O)CN(C2CCCCCC2)C(=O)C1c1ccccc1F |
| InChI | InChI=1S/C20H27FN2O2/c1-14(2)23-18(24)13-22(15-9-5-3-4-6-10-15)20(25)19(23)16-11-7-8-12-17(16)21/h7-8,11-12,14-15,19H,3-6,9-10,13H2,1-2H3 |
| InChIKey | CUJRBIFTUCZBOF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |