C18H14N6O2S2 — CID 3244872
3,5-bis(1,3-benzoxazol-2-ylsulfanylmethyl)-1,2,4-triazol-4-amine (PubChem CID 3244872) has the molecular formula C18H14N6O2S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 3,5-bis(1,3-benzoxazol-2-ylsulfanylmethyl)-1,2,4-triazol-4-amine.
| Compound Name | 3,5-bis(1,3-benzoxazol-2-ylsulfanylmethyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 3244872 |
| Molecular Formula | C18H14N6O2S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 3,5-bis(1,3-benzoxazol-2-ylsulfanylmethyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(CSc2nc3ccccc3o2)nnc1CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C18H14N6O2S2/c19-24-15(9-27-17-20-11-5-1-3-7-13(11)25-17)22-23-16(24)10-28-18-21-12-6-2-4-8-14(12)26-18/h1-8H,9-10,19H2 |
| InChIKey | RFFVXUAVIRSHNV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |