About 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide
3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide (PubChem CID 3244897) has the molecular formula C16H23N3O2
and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
| PubChem CID | 3244897 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide |
| SMILES | CN(C)C(=O)N1CCCC(C(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C16H23N3O2/c1-18(2)16(21)19-10-6-9-14(12-19)15(20)17-11-13-7-4-3-5-8-13/h3-5,7-8,14H,6,9-12H2,1-2H3,(H,17,20) |
| InChIKey | SLTGFUYXDXBXDR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide?
The IUPAC name of 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide (CID 3244897) is 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide.
What is the SMILES notation for 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide?
The canonical SMILES for 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide is CN(C)C(=O)N1CCCC(C(=O)NCc2ccccc2)C1.
What is the InChIKey of 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide?
The InChIKey is SLTGFUYXDXBXDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O2/c1-18(2)16(21)19-10-6-9-14(12-19)15(20)17-11-13-7-4-3-5-8-13/h3-5,7-8,14H,6,9-12H2,1-2H3,(H,17,20).
What are the key properties of 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide?
3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide has a molecular weight of 289.38 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-benzyl-1-N,1-N-dimethylpiperidine-1,3-dicarboxamide is sourced from PubChem (CID 3244897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).