C22H21N3O4S — CID 3244938
7-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-8-one (PubChem CID 3244938) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 7-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-8-one.
| Compound Name | 7-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-8-one |
|---|---|
| PubChem CID | 3244938 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 7-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-8-one |
| SMILES | O=C(CCCn1c(=S)[nH]c2cc3c(cc2c1=O)OCO3)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H21N3O4S/c26-20(24-9-7-14-4-1-2-5-15(14)12-24)6-3-8-25-21(27)16-10-18-19(29-13-28-18)11-17(16)23-22(25)30/h1-2,4-5,10-11H,3,6-9,12-13H2,(H,23,30) |
| InChIKey | LVWIXINAGAFEGG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|