About N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide
N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 3245061) has the molecular formula C13H14N2O4S
and a molecular weight of 294.33 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| PubChem CID | 3245061 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)c2c(C)noc2C)c1 |
| InChI | InChI=1S/C13H14N2O4S/c1-8-13(10(3)19-14-8)20(17,18)15-12-6-4-5-11(7-12)9(2)16/h4-7,15H,1-3H3 |
| InChIKey | MZVWVVRFDDLKPE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The IUPAC name of N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (CID 3245061) is N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The canonical SMILES for N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide is CC(=O)c1cccc(NS(=O)(=O)c2c(C)noc2C)c1.
What is the InChIKey of N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The InChIKey is MZVWVVRFDDLKPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4S/c1-8-13(10(3)19-14-8)20(17,18)15-12-6-4-5-11(7-12)9(2)16/h4-7,15H,1-3H3.
What are the key properties of N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide has a molecular weight of 294.33 g/mol, XLogP of 2.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-acetylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 3245061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).