C18H16F2N2O3 — CID 3245111
N-(2,6-difluorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide (PubChem CID 3245111) has the molecular formula C18H16F2N2O3 and a molecular weight of 346.33 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide.
| Compound Name | N-(2,6-difluorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide |
|---|---|
| PubChem CID | 3245111 |
| Molecular Formula | C18H16F2N2O3 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide |
| SMILES | O=C(CCN1C(=O)C2C3C=CC(C3)C2C1=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C18H16F2N2O3/c19-11-2-1-3-12(20)16(11)21-13(23)6-7-22-17(24)14-9-4-5-10(8-9)15(14)18(22)25/h1-5,9-10,14-15H,6-8H2,(H,21,23) |
| InChIKey | IACFGXXXGCHYSI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|