About N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide (PubChem CID 3245275) has the molecular formula C17H23NO4S
and a molecular weight of 337.44 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide.
Molecular Properties
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide |
| PubChem CID | 3245275 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide |
| SMILES | CCCCC(=O)N(c1ccc(OCC)cc1)C1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C17H23NO4S/c1-3-5-6-17(19)18(15-11-12-23(20,21)13-15)14-7-9-16(10-8-14)22-4-2/h7-12,15H,3-6,13H2,1-2H3 |
| InChIKey | UISUMJSZFREORD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide?
The IUPAC name of N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide (CID 3245275) is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide.
What is the SMILES notation for N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide?
The canonical SMILES for N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide is CCCCC(=O)N(c1ccc(OCC)cc1)C1C=CS(=O)(=O)C1.
What is the InChIKey of N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide?
The InChIKey is UISUMJSZFREORD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4S/c1-3-5-6-17(19)18(15-11-12-23(20,21)13-15)14-7-9-16(10-8-14)22-4-2/h7-12,15H,3-6,13H2,1-2H3.
What are the key properties of N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide?
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide has a molecular weight of 337.44 g/mol, XLogP of 2.92, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-ethoxyphenyl)pentanamide is sourced from PubChem (CID 3245275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).