About N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide
N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide (PubChem CID 3245305) has the molecular formula C18H15Cl2N3O3
and a molecular weight of 392.24 g/mol. Its IUPAC name is N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide |
| PubChem CID | 3245305 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide |
| SMILES | O=C1Nc2ccccc2C(O)(C(=O)NC2CC2)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c19-13-8-7-11(9-14(13)20)23-17(25)22-15-4-2-1-3-12(15)18(23,26)16(24)21-10-5-6-10/h1-4,7-10,26H,5-6H2,(H,21,24)(H,22,25) |
| InChIKey | JKXNEWQEOGIYSJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide?
The IUPAC name of N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide (CID 3245305) is N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide.
What is the SMILES notation for N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide?
The canonical SMILES for N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide is O=C1Nc2ccccc2C(O)(C(=O)NC2CC2)N1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide?
The InChIKey is JKXNEWQEOGIYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Cl2N3O3/c19-13-8-7-11(9-14(13)20)23-17(25)22-15-4-2-1-3-12(15)18(23,26)16(24)21-10-5-6-10/h1-4,7-10,26H,5-6H2,(H,21,24)(H,22,25).
What are the key properties of N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide?
N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide has a molecular weight of 392.24 g/mol, XLogP of 3.47, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-3-(3,4-dichlorophenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide is sourced from PubChem (CID 3245305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).