C17H17N3O3 — CID 3245378
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-pyridin-2-ylpropanamide (PubChem CID 3245378) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-pyridin-2-ylpropanamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 3245378 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-pyridin-2-ylpropanamide |
| SMILES | CC(C(=O)Nc1ccccn1)N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C17H17N3O3/c1-9(15(21)19-12-4-2-3-7-18-12)20-16(22)13-10-5-6-11(8-10)14(13)17(20)23/h2-7,9-11,13-14H,8H2,1H3,(H,18,19,21) |
| InChIKey | ILBALVXWUVXFAY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|