C14H16N2 — CID 3245407
2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole (PubChem CID 3245407) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole.
| Compound Name | 2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole |
|---|---|
| PubChem CID | 3245407 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1C1=CCNCC1 |
| InChI | InChI=1S/C14H16N2/c1-10-14(11-6-8-15-9-7-11)12-4-2-3-5-13(12)16-10/h2-6,15-16H,7-9H2,1H3 |
| InChIKey | JLVLNPGKFHWCCQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |